C19H20N4O4 — CID 141042281
ethyl 2-[[4-(diazenecarbonyl)phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 141042281) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 2-[[4-(diazenecarbonyl)phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[[4-(diazenecarbonyl)phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 141042281 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl 2-[[4-(diazenecarbonyl)phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | [H]/N=N/C(=O)c1ccc(NC(=O)NC(Cc2ccccc2)C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H20N4O4/c1-2-27-18(25)16(12-13-6-4-3-5-7-13)22-19(26)21-15-10-8-14(9-11-15)17(24)23-20/h3-11,16,20H,2,12H2,1H3,(H2,21,22,26)/b23-20+ |
| InChIKey | MOGPTBSLPJEZIF-BSYVCWPDSA-N |
| XLogP | 3.15 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|