C28H13F12N — CID 141042862
N-butyl-2,3,4,5,10-pentafluoro-N-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)anthracen-1-amine (PubChem CID 141042862) has the molecular formula C28H13F12N and a molecular weight of 591.40 g/mol. Its IUPAC name is N-butyl-2,3,4,5,10-pentafluoro-N-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)anthracen-1-amine.
| Compound Name | N-butyl-2,3,4,5,10-pentafluoro-N-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)anthracen-1-amine |
|---|---|
| PubChem CID | 141042862 |
| Molecular Formula | C28H13F12N |
| Molecular Weight | 591.40 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | N-butyl-2,3,4,5,10-pentafluoro-N-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)anthracen-1-amine |
| SMILES | CCCCN(c1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)c1c(F)c(F)c(F)c2c(F)c3c(F)cccc3cc12 |
| InChI | InChI=1S/C28H13F12N/c1-2-3-7-41(28-21(35)15-14(20(34)25(28)39)18(32)22(36)23(37)19(15)33)27-10-8-9-5-4-6-11(29)12(9)16(30)13(10)17(31)24(38)26(27)40/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | GAZDRDJBKUJXIP-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.40 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|