C15H10F4N2 — CID 91586713
2,3,4,5-tetrafluoro-N,N-dimethylacridin-1-amine (PubChem CID 91586713) has the molecular formula C15H10F4N2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N,N-dimethylacridin-1-amine.
| Compound Name | 2,3,4,5-tetrafluoro-N,N-dimethylacridin-1-amine |
|---|---|
| PubChem CID | 91586713 |
| Molecular Formula | C15H10F4N2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N,N-dimethylacridin-1-amine |
| SMILES | CN(C)c1c(F)c(F)c(F)c2nc3c(F)cccc3cc12 |
| InChI | InChI=1S/C15H10F4N2/c1-21(2)15-8-6-7-4-3-5-9(16)13(7)20-14(8)11(18)10(17)12(15)19/h3-6H,1-2H3 |
| InChIKey | ZGOPWMZXMLKGBW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|