C33H38F5NSi — CID 141042779
N-[diethyl(nonyl)silyl]-4,5,6,7-tetrafluoro-N-(5-fluoronaphthalen-2-yl)naphthalen-1-amine (PubChem CID 141042779) has the molecular formula C33H38F5NSi and a molecular weight of 571.75 g/mol. Its IUPAC name is N-[diethyl(nonyl)silyl]-4,5,6,7-tetrafluoro-N-(5-fluoronaphthalen-2-yl)naphthalen-1-amine.
| Compound Name | N-[diethyl(nonyl)silyl]-4,5,6,7-tetrafluoro-N-(5-fluoronaphthalen-2-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 141042779 |
| Molecular Formula | C33H38F5NSi |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | N-[diethyl(nonyl)silyl]-4,5,6,7-tetrafluoro-N-(5-fluoronaphthalen-2-yl)naphthalen-1-amine |
| SMILES | CCCCCCCCC[Si](CC)(CC)N(c1ccc2c(F)cccc2c1)c1ccc(F)c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C33H38F5NSi/c1-4-7-8-9-10-11-12-20-40(5-2,6-3)39(24-16-17-25-23(21-24)14-13-15-27(25)34)30-19-18-28(35)31-26(30)22-29(36)32(37)33(31)38/h13-19,21-22H,4-12,20H2,1-3H3 |
| InChIKey | NSBFNVPHAICSMD-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|