C17H34N4O — CID 141044111
N-octyl-1,4,9-triazaspiro[5.5]undecane-1-carboxamide (PubChem CID 141044111) has the molecular formula C17H34N4O and a molecular weight of 310.49 g/mol. Its IUPAC name is N-octyl-1,4,9-triazaspiro[5.5]undecane-1-carboxamide.
| Compound Name | N-octyl-1,4,9-triazaspiro[5.5]undecane-1-carboxamide |
|---|---|
| PubChem CID | 141044111 |
| Molecular Formula | C17H34N4O |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | N-octyl-1,4,9-triazaspiro[5.5]undecane-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N1CCNCC12CCNCC2 |
| InChI | InChI=1S/C17H34N4O/c1-2-3-4-5-6-7-10-20-16(22)21-14-13-19-15-17(21)8-11-18-12-9-17/h18-19H,2-15H2,1H3,(H,20,22) |
| InChIKey | VXTIOFOHWDORHB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|