About 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate
1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate (PubChem CID 141044767) has the molecular formula C17H20O6
and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate |
| PubChem CID | 141044767 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC(=O)Cc1ccccc1)C(=O)OCCOC |
| InChI | InChI=1S/C17H20O6/c1-13(17(20)22-9-8-21-2)10-16(19)23-12-15(18)11-14-6-4-3-5-7-14/h3-7H,1,8-12H2,2H3 |
| InChIKey | NSAZFAXGRFAFET-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate?
The IUPAC name of 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate (CID 141044767) is 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate.
What is the SMILES notation for 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate?
The canonical SMILES for 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate is C=C(CC(=O)OCC(=O)Cc1ccccc1)C(=O)OCCOC.
What is the InChIKey of 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate?
The InChIKey is NSAZFAXGRFAFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O6/c1-13(17(20)22-9-8-21-2)10-16(19)23-12-15(18)11-14-6-4-3-5-7-14/h3-7H,1,8-12H2,2H3.
What are the key properties of 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate?
1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate has a molecular weight of 320.34 g/mol, XLogP of 1.48, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-methoxyethyl) 4-O-(2-oxo-3-phenylpropyl) 2-methylidenebutanedioate is sourced from PubChem (CID 141044767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).