C6H13N5O — CID 141046532
2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol (PubChem CID 141046532) has the molecular formula C6H13N5O and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol.
| Compound Name | 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 141046532 |
| Molecular Formula | C6H13N5O |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol |
| SMILES | NCc1nn(CCO)c(N)c1N |
| InChI | InChI=1S/C6H13N5O/c7-3-4-5(8)6(9)11(10-4)1-2-12/h12H,1-3,7-9H2 |
| InChIKey | RZCPBSXFYIDYJW-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |