About 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol
2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol (PubChem CID 141046532) has the molecular formula C6H13N5O
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol |
| PubChem CID | 141046532 |
| Molecular Formula | C6H13N5O |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol |
| SMILES | NCc1nn(CCO)c(N)c1N |
| InChI | InChI=1S/C6H13N5O/c7-3-4-5(8)6(9)11(10-4)1-2-12/h12H,1-3,7-9H2 |
| InChIKey | RZCPBSXFYIDYJW-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol?
The IUPAC name of 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol (CID 141046532) is 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol is NCc1nn(CCO)c(N)c1N.
What is the InChIKey of 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol?
The InChIKey is RZCPBSXFYIDYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5O/c7-3-4-5(8)6(9)11(10-4)1-2-12/h12H,1-3,7-9H2.
What are the key properties of 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol?
2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol has a molecular weight of 171.20 g/mol, XLogP of -1.50, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-diamino-3-(aminomethyl)pyrazol-1-yl]ethanol is sourced from PubChem (CID 141046532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).