C6H12N4O — CID 10197801
2-(4,5-diamino-3-methylpyrazol-1-yl)ethanol (PubChem CID 10197801) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-(4,5-diamino-3-methylpyrazol-1-yl)ethanol.
| Compound Name | 2-(4,5-diamino-3-methylpyrazol-1-yl)ethanol |
|---|---|
| PubChem CID | 10197801 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2-(4,5-diamino-3-methylpyrazol-1-yl)ethanol |
| SMILES | Cc1nn(CCO)c(N)c1N |
| InChI | InChI=1S/C6H12N4O/c1-4-5(7)6(8)10(9-4)2-3-11/h11H,2-3,7-8H2,1H3 |
| InChIKey | QBOQGVXXIUOJRM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |