About 2-butyldeca-1,3-dienyl(trimethyl)silane
2-butyldeca-1,3-dienyl(trimethyl)silane (PubChem CID 141047468) has the molecular formula C17H34Si
and a molecular weight of 266.54 g/mol. Its IUPAC name is 2-butyldeca-1,3-dienyl(trimethyl)silane.
Molecular Properties
| Compound Name | 2-butyldeca-1,3-dienyl(trimethyl)silane |
| PubChem CID | 141047468 |
| Molecular Formula | C17H34Si |
| Molecular Weight | 266.54 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-butyldeca-1,3-dienyl(trimethyl)silane |
| SMILES | CCCCCCC=CC(=C[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C17H34Si/c1-6-8-10-11-12-13-15-17(14-9-7-2)16-18(3,4)5/h13,15-16H,6-12,14H2,1-5H3 |
| InChIKey | RWCHGWKKRPIUEX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-butyldeca-1,3-dienyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyldeca-1,3-dienyl(trimethyl)silane?
The IUPAC name of 2-butyldeca-1,3-dienyl(trimethyl)silane (CID 141047468) is 2-butyldeca-1,3-dienyl(trimethyl)silane.
What is the SMILES notation for 2-butyldeca-1,3-dienyl(trimethyl)silane?
The canonical SMILES for 2-butyldeca-1,3-dienyl(trimethyl)silane is CCCCCCC=CC(=C[Si](C)(C)C)CCCC.
What is the InChIKey of 2-butyldeca-1,3-dienyl(trimethyl)silane?
The InChIKey is RWCHGWKKRPIUEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34Si/c1-6-8-10-11-12-13-15-17(14-9-7-2)16-18(3,4)5/h13,15-16H,6-12,14H2,1-5H3.
What are the key properties of 2-butyldeca-1,3-dienyl(trimethyl)silane?
2-butyldeca-1,3-dienyl(trimethyl)silane has a molecular weight of 266.54 g/mol, XLogP of 6.51, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyldeca-1,3-dienyl(trimethyl)silane is sourced from PubChem (CID 141047468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).