C28H36N2O2 — CID 141047743
(2R,3S)-3-(N-butylanilino)-1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol (PubChem CID 141047743) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is (2R,3S)-3-(N-butylanilino)-1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-(N-butylanilino)-1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 141047743 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | (2R,3S)-3-(N-butylanilino)-1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol |
| SMILES | CCCCN(c1ccccc1)[C@@H](Cc1ccccc1)[C@H](O)CNCc1cccc(OC)c1 |
| InChI | InChI=1S/C28H36N2O2/c1-3-4-18-30(25-15-9-6-10-16-25)27(20-23-12-7-5-8-13-23)28(31)22-29-21-24-14-11-17-26(19-24)32-2/h5-17,19,27-29,31H,3-4,18,20-22H2,1-2H3/t27-,28+/m0/s1 |
| InChIKey | RLZHOHYXAGFIDG-WUFINQPMSA-N |
| XLogP | 5.06 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |