C27H42N2O5S — CID 154504440
N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-N-(5-methoxypentyl)propane-1-sulfonamide (PubChem CID 154504440) has the molecular formula C27H42N2O5S and a molecular weight of 506.71 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-N-(5-methoxypentyl)propane-1-sulfonamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-N-(5-methoxypentyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 154504440 |
| Molecular Formula | C27H42N2O5S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-N-(5-methoxypentyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N(CCCCCOC)[C@@H](Cc1ccccc1)[C@H](O)CNCc1cccc(OC)c1 |
| InChI | InChI=1S/C27H42N2O5S/c1-4-18-35(31,32)29(16-9-6-10-17-33-2)26(20-23-12-7-5-8-13-23)27(30)22-28-21-24-14-11-15-25(19-24)34-3/h5,7-8,11-15,19,26-28,30H,4,6,9-10,16-18,20-22H2,1-3H3/t26-,27+/m0/s1 |
| InChIKey | BPCNWSAQVHNXIY-RRPNLBNLSA-N |
| XLogP | 3.62 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|