C17H22O3 — CID 141047896
[1-(methoxymethyl)-2,3-dimethylinden-1-yl]methyl propanoate (PubChem CID 141047896) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [1-(methoxymethyl)-2,3-dimethylinden-1-yl]methyl propanoate.
| Compound Name | [1-(methoxymethyl)-2,3-dimethylinden-1-yl]methyl propanoate |
|---|---|
| PubChem CID | 141047896 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [1-(methoxymethyl)-2,3-dimethylinden-1-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1(COC)C(C)=C(C)c2ccccc21 |
| InChI | InChI=1S/C17H22O3/c1-5-16(18)20-11-17(10-19-4)13(3)12(2)14-8-6-7-9-15(14)17/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | DWINEEVPRTZUSR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |