About 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one
1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one (PubChem CID 141048969) has the molecular formula C27H24BrOP
and a molecular weight of 475.37 g/mol. Its IUPAC name is 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one.
Molecular Properties
| Compound Name | 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one |
| PubChem CID | 141048969 |
| Molecular Formula | C27H24BrOP |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one |
| SMILES | O=C(Cc1ccccc1)CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24BrOP/c28-30(25-15-7-2-8-16-25,26-17-9-3-10-18-26,27-19-11-4-12-20-27)22-24(29)21-23-13-5-1-6-14-23/h1-20H,21-22H2 |
| InChIKey | ZXKJFXHYMPLXCE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one?
The IUPAC name of 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one (CID 141048969) is 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one.
What is the SMILES notation for 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one?
The canonical SMILES for 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one is O=C(Cc1ccccc1)CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one?
The InChIKey is ZXKJFXHYMPLXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24BrOP/c28-30(25-15-7-2-8-16-25,26-17-9-3-10-18-26,27-19-11-4-12-20-27)22-24(29)21-23-13-5-1-6-14-23/h1-20H,21-22H2.
What are the key properties of 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one?
1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one has a molecular weight of 475.37 g/mol, XLogP of 5.64, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bromo(triphenyl)-λ5-phosphanyl]-3-phenylpropan-2-one is sourced from PubChem (CID 141048969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).