C22H24N2O2S2 — CID 141049260
phenyl N-[3-(2-amino-4-tert-butyl-5-methylsulfanylthiophen-3-yl)phenyl]carbamate (PubChem CID 141049260) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is phenyl N-[3-(2-amino-4-tert-butyl-5-methylsulfanylthiophen-3-yl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(2-amino-4-tert-butyl-5-methylsulfanylthiophen-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 141049260 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | phenyl N-[3-(2-amino-4-tert-butyl-5-methylsulfanylthiophen-3-yl)phenyl]carbamate |
| SMILES | CSc1sc(N)c(-c2cccc(NC(=O)Oc3ccccc3)c2)c1C(C)(C)C |
| InChI | InChI=1S/C22H24N2O2S2/c1-22(2,3)18-17(19(23)28-20(18)27-4)14-9-8-10-15(13-14)24-21(25)26-16-11-6-5-7-12-16/h5-13H,23H2,1-4H3,(H,24,25) |
| InChIKey | LCVDGYIGBKYKTF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |