C21H28O2S8 — CID 141049422
S-[[5-methyl-2-[2-[2-[4-methyl-5-(prop-2-enoylsulfanylmethyl)-1,3-dithiol-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiol-4-yl]methyl] prop-2-enethioate (PubChem CID 141049422) has the molecular formula C21H28O2S8 and a molecular weight of 568.99 g/mol. Its IUPAC name is S-[[5-methyl-2-[2-[2-[4-methyl-5-(prop-2-enoylsulfanylmethyl)-1,3-dithiol-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiol-4-yl]methyl] prop-2-enethioate.
| Compound Name | S-[[5-methyl-2-[2-[2-[4-methyl-5-(prop-2-enoylsulfanylmethyl)-1,3-dithiol-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiol-4-yl]methyl] prop-2-enethioate |
|---|---|
| PubChem CID | 141049422 |
| Molecular Formula | C21H28O2S8 |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 567.99 |
| IUPAC Name | S-[[5-methyl-2-[2-[2-[4-methyl-5-(prop-2-enoylsulfanylmethyl)-1,3-dithiol-2-yl]ethylsulfanylmethylsulfanyl]ethyl]-1,3-dithiol-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1=C(C)SC(CCSCSCCC2SC(C)=C(CSC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C21H28O2S8/c1-5-18(22)26-11-16-14(3)28-20(30-16)7-9-24-13-25-10-8-21-29-15(4)17(31-21)12-27-19(23)6-2/h5-6,20-21H,1-2,7-13H2,3-4H3 |
| InChIKey | FSVGZDUIUMXMOD-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|