About [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol
[2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol (PubChem CID 141049527) has the molecular formula C5H8OS3
and a molecular weight of 180.32 g/mol. Its IUPAC name is [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol |
| PubChem CID | 141049527 |
| Molecular Formula | C5H8OS3 |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 179.97 |
| IUPAC Name | [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol |
| SMILES | OCC1=CSC(CS)S1 |
| InChI | InChI=1S/C5H8OS3/c6-1-4-3-8-5(2-7)9-4/h3,5-7H,1-2H2 |
| InChIKey | KSFWGPPAGGDUMX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol?
The IUPAC name of [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol (CID 141049527) is [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol.
What is the SMILES notation for [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol?
The canonical SMILES for [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol is OCC1=CSC(CS)S1.
What is the InChIKey of [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol?
The InChIKey is KSFWGPPAGGDUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS3/c6-1-4-3-8-5(2-7)9-4/h3,5-7H,1-2H2.
What are the key properties of [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol?
[2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol has a molecular weight of 180.32 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(sulfanylmethyl)-1,3-dithiol-4-yl]methanol is sourced from PubChem (CID 141049527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).