C11H12N2OS — CID 141050819
2-[4-(1,2-thiazol-5-yl)phenoxy]ethanamine (PubChem CID 141050819) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-[4-(1,2-thiazol-5-yl)phenoxy]ethanamine.
| Compound Name | 2-[4-(1,2-thiazol-5-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 141050819 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-[4-(1,2-thiazol-5-yl)phenoxy]ethanamine |
| SMILES | NCCOc1ccc(-c2ccns2)cc1 |
| InChI | InChI=1S/C11H12N2OS/c12-6-8-14-10-3-1-9(2-4-10)11-5-7-13-15-11/h1-5,7H,6,8,12H2 |
| InChIKey | VQKSOJMTEVNMAA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |