C12H11F3N2OS — CID 18523680
2-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]phenoxy]ethanamine (PubChem CID 18523680) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]phenoxy]ethanamine.
| Compound Name | 2-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 18523680 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]phenoxy]ethanamine |
| SMILES | NCCOc1ccc(-c2nc(C(F)(F)F)cs2)cc1 |
| InChI | InChI=1S/C12H11F3N2OS/c13-12(14,15)10-7-19-11(17-10)8-1-3-9(4-2-8)18-6-5-16/h1-4,7H,5-6,16H2 |
| InChIKey | AGBUNMLCUCLRPQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |