C27H24N4O2 — CID 141051162
5-[2-[4-[3-(methylamino)propoxy]phenyl]-5-pyridin-4-yl-1H-imidazol-4-yl]inden-1-one (PubChem CID 141051162) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 5-[2-[4-[3-(methylamino)propoxy]phenyl]-5-pyridin-4-yl-1H-imidazol-4-yl]inden-1-one.
| Compound Name | 5-[2-[4-[3-(methylamino)propoxy]phenyl]-5-pyridin-4-yl-1H-imidazol-4-yl]inden-1-one |
|---|---|
| PubChem CID | 141051162 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 5-[2-[4-[3-(methylamino)propoxy]phenyl]-5-pyridin-4-yl-1H-imidazol-4-yl]inden-1-one |
| SMILES | CNCCCOc1ccc(-c2nc(-c3ccc4c(c3)C=CC4=O)c(-c3ccncc3)[nH]2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-28-13-2-16-33-22-7-3-19(4-8-22)27-30-25(18-11-14-29-15-12-18)26(31-27)21-5-9-23-20(17-21)6-10-24(23)32/h3-12,14-15,17,28H,2,13,16H2,1H3,(H,30,31) |
| InChIKey | SSFPXMZLLNCUQA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|