C12H15NO3 — CID 141051688
N-[2-[[(3R)-3-methyloxiran-2-yl]methoxy]phenyl]acetamide (PubChem CID 141051688) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[2-[[(3R)-3-methyloxiran-2-yl]methoxy]phenyl]acetamide.
| Compound Name | N-[2-[[(3R)-3-methyloxiran-2-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 141051688 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[2-[[(3R)-3-methyloxiran-2-yl]methoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1OCC1O[C@@H]1C |
| InChI | InChI=1S/C12H15NO3/c1-8-12(16-8)7-15-11-6-4-3-5-10(11)13-9(2)14/h3-6,8,12H,7H2,1-2H3,(H,13,14)/t8-,12?/m1/s1 |
| InChIKey | MSKWDNYJWZXAMO-SZSXPDSJSA-N |
| XLogP | 1.81 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|