C16H11N3S2 — CID 141052128
6-phenyl-4-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 141052128) has the molecular formula C16H11N3S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 6-phenyl-4-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 6-phenyl-4-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 141052128 |
| Molecular Formula | C16H11N3S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-phenyl-4-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2cc3c(Sc4cccs4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C16H11N3S2/c1-2-5-11(6-3-1)13-9-12-15(19-13)17-10-18-16(12)21-14-7-4-8-20-14/h1-10H,(H,17,18,19) |
| InChIKey | FPXIKFREZVYDEL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |