C32H36N2 — CID 141056412
N-tert-butyl-4-[4-(tert-butylamino)phenyl]-2,3-diphenylaniline (PubChem CID 141056412) has the molecular formula C32H36N2 and a molecular weight of 448.65 g/mol. Its IUPAC name is N-tert-butyl-4-[4-(tert-butylamino)phenyl]-2,3-diphenylaniline.
| Compound Name | N-tert-butyl-4-[4-(tert-butylamino)phenyl]-2,3-diphenylaniline |
|---|---|
| PubChem CID | 141056412 |
| Molecular Formula | C32H36N2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | N-tert-butyl-4-[4-(tert-butylamino)phenyl]-2,3-diphenylaniline |
| SMILES | CC(C)(C)Nc1ccc(-c2ccc(NC(C)(C)C)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H36N2/c1-31(2,3)33-26-19-17-23(18-20-26)27-21-22-28(34-32(4,5)6)30(25-15-11-8-12-16-25)29(27)24-13-9-7-10-14-24/h7-22,33-34H,1-6H3 |
| InChIKey | UGPFZFPUVHCWBK-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |