C10H20N4O3 — CID 141056869
N-(2-amino-2-oxoethyl)-3-(tert-butylcarbamoylamino)propanamide (PubChem CID 141056869) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(tert-butylcarbamoylamino)propanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(tert-butylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 141056869 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(tert-butylcarbamoylamino)propanamide |
| SMILES | CC(C)(C)NC(=O)NCCC(=O)NCC(N)=O |
| InChI | InChI=1S/C10H20N4O3/c1-10(2,3)14-9(17)12-5-4-8(16)13-6-7(11)15/h4-6H2,1-3H3,(H2,11,15)(H,13,16)(H2,12,14,17) |
| InChIKey | PUBQQRAFRIXXAP-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |