C11H17NO — CID 141057839
2-(2,3,4,5-tetrahydro-1H-inden-5-yloxy)ethanamine (PubChem CID 141057839) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-(2,3,4,5-tetrahydro-1H-inden-5-yloxy)ethanamine.
| Compound Name | 2-(2,3,4,5-tetrahydro-1H-inden-5-yloxy)ethanamine |
|---|---|
| PubChem CID | 141057839 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-(2,3,4,5-tetrahydro-1H-inden-5-yloxy)ethanamine |
| SMILES | NCCOC1C=CC2=C(CCC2)C1 |
| InChI | InChI=1S/C11H17NO/c12-6-7-13-11-5-4-9-2-1-3-10(9)8-11/h4-5,11H,1-3,6-8,12H2 |
| InChIKey | FGYHAJWDOMFNHN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |