C16H12N2O9 — CID 141058063
2,3-diamino-5-(2,5-dicarboxyphenoxy)terephthalic acid (PubChem CID 141058063) has the molecular formula C16H12N2O9 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2,3-diamino-5-(2,5-dicarboxyphenoxy)terephthalic acid.
| Compound Name | 2,3-diamino-5-(2,5-dicarboxyphenoxy)terephthalic acid |
|---|---|
| PubChem CID | 141058063 |
| Molecular Formula | C16H12N2O9 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2,3-diamino-5-(2,5-dicarboxyphenoxy)terephthalic acid |
| SMILES | Nc1c(C(=O)O)cc(Oc2cc(C(=O)O)ccc2C(=O)O)c(C(=O)O)c1N |
| InChI | InChI=1S/C16H12N2O9/c17-11-7(15(23)24)4-9(10(12(11)18)16(25)26)27-8-3-5(13(19)20)1-2-6(8)14(21)22/h1-4H,17-18H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | PKDSGTJXLVJDDK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 210.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|