2-diphenylphosphanyloxyterephthalic acid

C20H15O5P — CID 171479707

IUPAC2-diphenylphosphanyloxyterephthalic acid
SMILESO=C(O)c1ccc(C(=O)O)c(OP(c2ccccc2)c2ccccc2)c1
InChIInChI=1S/C20H15O5P/c21-19(22)14-11-12-17(20(23)24)18(13-14)25-26(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H,(H,21,22)(H,23,24)
InChIKeyDVHUFAJEIMADRQ-UHFFFAOYSA-N
MW366.31 g/mol
LogP3.51
Rot. Bonds6

About 2-diphenylphosphanyloxyterephthalic acid

2-diphenylphosphanyloxyterephthalic acid (PubChem CID 171479707) has the molecular formula C20H15O5P and a molecular weight of 366.31 g/mol. Its IUPAC name is 2-diphenylphosphanyloxyterephthalic acid.

Molecular Properties

Compound Name2-diphenylphosphanyloxyterephthalic acid
PubChem CID171479707
Molecular FormulaC20H15O5P
Molecular Weight366.31 g/mol
Exact Mass366.07
IUPAC Name2-diphenylphosphanyloxyterephthalic acid
SMILESO=C(O)c1ccc(C(=O)O)c(OP(c2ccccc2)c2ccccc2)c1
InChIInChI=1S/C20H15O5P/c21-19(22)14-11-12-17(20(23)24)18(13-14)25-26(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H,(H,21,22)(H,23,24)
InChIKeyDVHUFAJEIMADRQ-UHFFFAOYSA-N
XLogP3.51
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.31
LogP ≤ 53.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-diphenylphosphanyloxyterephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

carbonic acid;2-(2,5-dicarboxyphenyl)peroxyterephthalic acid
CID 88603711
2-diphenylphosphoryloxyterephthalic acid
CID 175552705
2-carboxyperoxycarbonyloxyterephthalic acid
CID 21276584
2-pentoxyterephthalic acid
CID 86182031
4-(2-carboxybenzoyl)benzene-1,3-dicarboxylic acid
CID 143439046
2-octadecoxyterephthalic acid
CID 142668937
4-diphenylphosphanyl-3-hydroxybenzoic acid
CID 101171286
benzene-1,2,4-tricarboxylic acid;dihydrate
CID 70292833
4-benzoyl-3-(4-carboxyphenoxy)benzoic acid
CID 70204414
2-(2-methylsulfanylethoxy)terephthalic acid
CID 175240037
2-[[2-bis(2-carboxyphenyl)phosphanyloxyphenoxy]-(2-carboxyphenyl)phosphanyl]benzoic acid
CID 177097800
3,4-diphenoxybenzoic acid
CID 70590459

Frequently Asked Questions

What is the IUPAC name of 2-diphenylphosphanyloxyterephthalic acid?
The IUPAC name of 2-diphenylphosphanyloxyterephthalic acid (CID 171479707) is 2-diphenylphosphanyloxyterephthalic acid.
What is the SMILES notation for 2-diphenylphosphanyloxyterephthalic acid?
The canonical SMILES for 2-diphenylphosphanyloxyterephthalic acid is O=C(O)c1ccc(C(=O)O)c(OP(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 2-diphenylphosphanyloxyterephthalic acid?
The InChIKey is DVHUFAJEIMADRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15O5P/c21-19(22)14-11-12-17(20(23)24)18(13-14)25-26(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H,(H,21,22)(H,23,24).
What are the key properties of 2-diphenylphosphanyloxyterephthalic acid?
2-diphenylphosphanyloxyterephthalic acid has a molecular weight of 366.31 g/mol, XLogP of 3.51, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphanyloxyterephthalic acid is sourced from PubChem (CID 171479707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).