C34H24O10P2 — CID 177097800
2-[[2-bis(2-carboxyphenyl)phosphanyloxyphenoxy]-(2-carboxyphenyl)phosphanyl]benzoic acid (PubChem CID 177097800) has the molecular formula C34H24O10P2 and a molecular weight of 654.50 g/mol. Its IUPAC name is 2-[[2-bis(2-carboxyphenyl)phosphanyloxyphenoxy]-(2-carboxyphenyl)phosphanyl]benzoic acid.
| Compound Name | 2-[[2-bis(2-carboxyphenyl)phosphanyloxyphenoxy]-(2-carboxyphenyl)phosphanyl]benzoic acid |
|---|---|
| PubChem CID | 177097800 |
| Molecular Formula | C34H24O10P2 |
| Molecular Weight | 654.50 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | 2-[[2-bis(2-carboxyphenyl)phosphanyloxyphenoxy]-(2-carboxyphenyl)phosphanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1P(Oc1ccccc1OP(c1ccccc1C(=O)O)c1ccccc1C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C34H24O10P2/c35-31(36)21-11-1-7-17-27(21)45(28-18-8-2-12-22(28)32(37)38)43-25-15-5-6-16-26(25)44-46(29-19-9-3-13-23(29)33(39)40)30-20-10-4-14-24(30)34(41)42/h1-20H,(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | MUZDXOMCJDPHJD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|