About sodium coronen-1-yl sulfate
sodium coronen-1-yl sulfate (PubChem CID 141058830) has the molecular formula C24H11NaO4S
and a molecular weight of 418.41 g/mol. Its IUPAC name is sodium coronen-1-yl sulfate.
Molecular Properties
| Compound Name | sodium coronen-1-yl sulfate |
| PubChem CID | 141058830 |
| Molecular Formula | C24H11NaO4S |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | sodium coronen-1-yl sulfate |
| SMILES | O=S(=O)([O-])Oc1cc2ccc3ccc4ccc5ccc6ccc1c1c6c5c4c3c21.[Na+] |
| InChI | InChI=1S/C24H12O4S.Na/c25-29(26,27)28-18-11-16-8-7-14-4-2-12-1-3-13-5-6-15-9-10-17(18)24-22(15)20(13)19(12)21(14)23(16)24;/h1-11H,(H,25,26,27);/q;+1/p-1 |
| InChIKey | SUJDSKGQCOJXMR-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium coronen-1-yl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium coronen-1-yl sulfate?
The IUPAC name of sodium coronen-1-yl sulfate (CID 141058830) is sodium coronen-1-yl sulfate.
What is the SMILES notation for sodium coronen-1-yl sulfate?
The canonical SMILES for sodium coronen-1-yl sulfate is O=S(=O)([O-])Oc1cc2ccc3ccc4ccc5ccc6ccc1c1c6c5c4c3c21.[Na+].
What is the InChIKey of sodium coronen-1-yl sulfate?
The InChIKey is SUJDSKGQCOJXMR-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H12O4S.Na/c25-29(26,27)28-18-11-16-8-7-14-4-2-12-1-3-13-5-6-15-9-10-17(18)24-22(15)20(13)19(12)21(14)23(16)24;/h1-11H,(H,25,26,27);/q;+1/p-1.
What are the key properties of sodium coronen-1-yl sulfate?
sodium coronen-1-yl sulfate has a molecular weight of 418.41 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium coronen-1-yl sulfate is sourced from PubChem (CID 141058830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).