C23H20N2O4 — CID 141060202
ethyl 2-[2-(naphthalen-1-ylamino)-2-oxoacetyl]-1,3-dihydroindole-2-carboxylate (PubChem CID 141060202) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 2-[2-(naphthalen-1-ylamino)-2-oxoacetyl]-1,3-dihydroindole-2-carboxylate.
| Compound Name | ethyl 2-[2-(naphthalen-1-ylamino)-2-oxoacetyl]-1,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 141060202 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | ethyl 2-[2-(naphthalen-1-ylamino)-2-oxoacetyl]-1,3-dihydroindole-2-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)C(=O)Nc2cccc3ccccc23)Cc2ccccc2N1 |
| InChI | InChI=1S/C23H20N2O4/c1-2-29-22(28)23(14-16-9-4-6-12-18(16)25-23)20(26)21(27)24-19-13-7-10-15-8-3-5-11-17(15)19/h3-13,25H,2,14H2,1H3,(H,24,27) |
| InChIKey | NXJVQEVDHROLDR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|