C18H34O5 — CID 141060815
4,4-bis(2-methylpentan-2-ylperoxy)cyclohexan-1-one (PubChem CID 141060815) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4,4-bis(2-methylpentan-2-ylperoxy)cyclohexan-1-one.
| Compound Name | 4,4-bis(2-methylpentan-2-ylperoxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 141060815 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4,4-bis(2-methylpentan-2-ylperoxy)cyclohexan-1-one |
| SMILES | CCCC(C)(C)OOC1(OOC(C)(C)CCC)CCC(=O)CC1 |
| InChI | InChI=1S/C18H34O5/c1-7-11-16(3,4)20-22-18(13-9-15(19)10-14-18)23-21-17(5,6)12-8-2/h7-14H2,1-6H3 |
| InChIKey | OFRHARDRGSUYEO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|