C12H10Cl2N2 — CID 141060907
N-[(3,5-dichloro-4-pyridinyl)methyl]aniline (PubChem CID 141060907) has the molecular formula C12H10Cl2N2 and a molecular weight of 253.13 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-pyridinyl)methyl]aniline.
| Compound Name | N-[(3,5-dichloro-4-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 141060907 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | N-[(3,5-dichloro-4-pyridinyl)methyl]aniline |
| SMILES | Clc1cncc(Cl)c1CNc1ccccc1 |
| InChI | InChI=1S/C12H10Cl2N2/c13-11-7-15-8-12(14)10(11)6-16-9-4-2-1-3-5-9/h1-5,7-8,16H,6H2 |
| InChIKey | ODQSFIZGOLOQDX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |