C17H16N4O2S — CID 141060958
N-[2-amino-5-(1,4-diazepin-1-yl)phenyl]benzenesulfonamide (PubChem CID 141060958) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-[2-amino-5-(1,4-diazepin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-amino-5-(1,4-diazepin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141060958 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[2-amino-5-(1,4-diazepin-1-yl)phenyl]benzenesulfonamide |
| SMILES | Nc1ccc(N2C=CC=NC=C2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O2S/c18-16-8-7-14(21-11-4-9-19-10-12-21)13-17(16)20-24(22,23)15-5-2-1-3-6-15/h1-13,20H,18H2 |
| InChIKey | DLPSBKKATSDHQQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|