C16H14FNO2 — CID 141064356
1-(4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one (PubChem CID 141064356) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one.
| Compound Name | 1-(4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 141064356 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one |
| SMILES | CC1(C)OC(=O)N(c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C16H14FNO2/c1-16(2)13-5-3-4-6-14(13)18(15(19)20-16)12-9-7-11(17)8-10-12/h3-10H,1-2H3 |
| InChIKey | MDTQEIHKKOWPNF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |