C15H21NO4 — CID 141028651
1-(diethoxymethyl)-4,4-dimethyl-3,1-benzoxazin-2-one (PubChem CID 141028651) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-(diethoxymethyl)-4,4-dimethyl-3,1-benzoxazin-2-one.
| Compound Name | 1-(diethoxymethyl)-4,4-dimethyl-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 141028651 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-(diethoxymethyl)-4,4-dimethyl-3,1-benzoxazin-2-one |
| SMILES | CCOC(OCC)N1C(=O)OC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H21NO4/c1-5-18-14(19-6-2)16-12-10-8-7-9-11(12)15(3,4)20-13(16)17/h7-10,14H,5-6H2,1-4H3 |
| InChIKey | FTETZKFEWZXJMW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|