C34H26FNO3 — CID 141064538
(4-fluorophenyl)-[4-(hydroxyiminomethyl)-2-(trityloxymethyl)phenyl]methanone (PubChem CID 141064538) has the molecular formula C34H26FNO3 and a molecular weight of 515.58 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(hydroxyiminomethyl)-2-(trityloxymethyl)phenyl]methanone.
| Compound Name | (4-fluorophenyl)-[4-(hydroxyiminomethyl)-2-(trityloxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 141064538 |
| Molecular Formula | C34H26FNO3 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | (4-fluorophenyl)-[4-(hydroxyiminomethyl)-2-(trityloxymethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(F)cc1)c1ccc(C=NO)cc1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H26FNO3/c35-31-19-17-26(18-20-31)33(37)32-21-16-25(23-36-38)22-27(32)24-39-34(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-23,38H,24H2 |
| InChIKey | MQMYNWOBNJLQMH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|