C14H17NO — CID 141065853
6-(3-methoxyphenyl)-1-methyl-2,3-dihydroazepine (PubChem CID 141065853) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-1-methyl-2,3-dihydroazepine.
| Compound Name | 6-(3-methoxyphenyl)-1-methyl-2,3-dihydroazepine |
|---|---|
| PubChem CID | 141065853 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-(3-methoxyphenyl)-1-methyl-2,3-dihydroazepine |
| SMILES | COc1cccc(C2=CN(C)CCC=C2)c1 |
| InChI | InChI=1S/C14H17NO/c1-15-9-4-3-6-13(11-15)12-7-5-8-14(10-12)16-2/h3,5-8,10-11H,4,9H2,1-2H3 |
| InChIKey | MVVKUJZQOZFLIR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |