C18H25N3 — CID 141067018
5-[2-[(tert-butylhydrazinylidene)methyl]phenyl]-N,N-dimethylcyclopenta-1,3-dien-1-amine (PubChem CID 141067018) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 5-[2-[(tert-butylhydrazinylidene)methyl]phenyl]-N,N-dimethylcyclopenta-1,3-dien-1-amine.
| Compound Name | 5-[2-[(tert-butylhydrazinylidene)methyl]phenyl]-N,N-dimethylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 141067018 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 5-[2-[(tert-butylhydrazinylidene)methyl]phenyl]-N,N-dimethylcyclopenta-1,3-dien-1-amine |
| SMILES | CN(C)C1=CC=CC1c1ccccc1C=NNC(C)(C)C |
| InChI | InChI=1S/C18H25N3/c1-18(2,3)20-19-13-14-9-6-7-10-15(14)16-11-8-12-17(16)21(4)5/h6-13,16,20H,1-5H3 |
| InChIKey | KGXUCYINWZTFRB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|