C18H23N — CID 154426356
N-tert-butyl-1-[2-(2,4-dimethylcyclopenta-2,4-dien-1-yl)phenyl]methanimine (PubChem CID 154426356) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-tert-butyl-1-[2-(2,4-dimethylcyclopenta-2,4-dien-1-yl)phenyl]methanimine.
| Compound Name | N-tert-butyl-1-[2-(2,4-dimethylcyclopenta-2,4-dien-1-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 154426356 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-tert-butyl-1-[2-(2,4-dimethylcyclopenta-2,4-dien-1-yl)phenyl]methanimine |
| SMILES | CC1=CC(c2ccccc2/C=N/C(C)(C)C)C(C)=C1 |
| InChI | InChI=1S/C18H23N/c1-13-10-14(2)17(11-13)16-9-7-6-8-15(16)12-19-18(3,4)5/h6-12,17H,1-5H3/b19-12+ |
| InChIKey | HBBUUWAPLHTWRZ-XDHOZWIPSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|