C14H11BrO2 — CID 141067188
2-(1-bromonaphthalen-2-yl)-2-methyl-1,3-dioxole (PubChem CID 141067188) has the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)-2-methyl-1,3-dioxole.
| Compound Name | 2-(1-bromonaphthalen-2-yl)-2-methyl-1,3-dioxole |
|---|---|
| PubChem CID | 141067188 |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)-2-methyl-1,3-dioxole |
| SMILES | CC1(c2ccc3ccccc3c2Br)OC=CO1 |
| InChI | InChI=1S/C14H11BrO2/c1-14(16-8-9-17-14)12-7-6-10-4-2-3-5-11(10)13(12)15/h2-9H,1H3 |
| InChIKey | GFMOMZFCTKSSIG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |