C12H12N2O5 — CID 141068722
9-hydroxy-6-methyl-7-oxo-8,9-dihydro-[1,3]dioxolo[4,5-f]quinoline-8-carboxamide (PubChem CID 141068722) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 9-hydroxy-6-methyl-7-oxo-8,9-dihydro-[1,3]dioxolo[4,5-f]quinoline-8-carboxamide.
| Compound Name | 9-hydroxy-6-methyl-7-oxo-8,9-dihydro-[1,3]dioxolo[4,5-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 141068722 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 9-hydroxy-6-methyl-7-oxo-8,9-dihydro-[1,3]dioxolo[4,5-f]quinoline-8-carboxamide |
| SMILES | CN1C(=O)C(C(N)=O)C(O)c2c1ccc1c2OCO1 |
| InChI | InChI=1S/C12H12N2O5/c1-14-5-2-3-6-10(19-4-18-6)7(5)9(15)8(11(13)16)12(14)17/h2-3,8-9,15H,4H2,1H3,(H2,13,16) |
| InChIKey | AGAOUPQCKTXFGP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|