C8H6ClNS — CID 141073454
4-chloro-2-methylthieno[3,4-b]pyridine (PubChem CID 141073454) has the molecular formula C8H6ClNS and a molecular weight of 183.66 g/mol. Its IUPAC name is 4-chloro-2-methylthieno[3,4-b]pyridine.
| Compound Name | 4-chloro-2-methylthieno[3,4-b]pyridine |
|---|---|
| PubChem CID | 141073454 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.66 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 4-chloro-2-methylthieno[3,4-b]pyridine |
| SMILES | Cc1cc(Cl)c2cscc2n1 |
| InChI | InChI=1S/C8H6ClNS/c1-5-2-7(9)6-3-11-4-8(6)10-5/h2-4H,1H3 |
| InChIKey | NQNGMIRBSONEOO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |