C15H16F2N4O — CID 141073558
4-[(2,3-difluorophenyl)methoxy]-2-piperazin-1-ylpyrimidine (PubChem CID 141073558) has the molecular formula C15H16F2N4O and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methoxy]-2-piperazin-1-ylpyrimidine.
| Compound Name | 4-[(2,3-difluorophenyl)methoxy]-2-piperazin-1-ylpyrimidine |
|---|---|
| PubChem CID | 141073558 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methoxy]-2-piperazin-1-ylpyrimidine |
| SMILES | Fc1cccc(COc2ccnc(N3CCNCC3)n2)c1F |
| InChI | InChI=1S/C15H16F2N4O/c16-12-3-1-2-11(14(12)17)10-22-13-4-5-19-15(20-13)21-8-6-18-7-9-21/h1-5,18H,6-10H2 |
| InChIKey | JSCNWYDIDXNLTL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |