C27H34F3NO — CID 141074424
N-[(4-dec-1-ynylphenyl)methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 141074424) has the molecular formula C27H34F3NO and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[(4-dec-1-ynylphenyl)methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | N-[(4-dec-1-ynylphenyl)methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 141074424 |
| Molecular Formula | C27H34F3NO |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[(4-dec-1-ynylphenyl)methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | CCCCCCCCC#Cc1ccc(CONC(C)(C)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H34F3NO/c1-4-5-6-7-8-9-10-11-12-22-13-15-23(16-14-22)21-32-31-26(2,3)24-17-19-25(20-18-24)27(28,29)30/h13-20,31H,4-10,21H2,1-3H3 |
| InChIKey | CGOMXENESROKFC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|