C29H30F3NO — CID 141168379
N-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 141168379) has the molecular formula C29H30F3NO and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | N-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 141168379 |
| Molecular Formula | C29H30F3NO |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methoxy]-2-[4-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | CCCCc1ccc(C#Cc2ccc(CONC(C)(C)c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H30F3NO/c1-4-5-6-22-7-9-23(10-8-22)11-12-24-13-15-25(16-14-24)21-34-33-28(2,3)26-17-19-27(20-18-26)29(30,31)32/h7-10,13-20,33H,4-6,21H2,1-3H3 |
| InChIKey | UCSFSVOFRLNPPS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|