C26H27NO — CID 54144881
1-cyclopropylidene-1-(2,4-dimethylphenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine (PubChem CID 54144881) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-cyclopropylidene-1-(2,4-dimethylphenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine.
| Compound Name | 1-cyclopropylidene-1-(2,4-dimethylphenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
|---|---|
| PubChem CID | 54144881 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-cyclopropylidene-1-(2,4-dimethylphenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
| SMILES | Cc1ccc(C(NOCc2cccc(-c3ccccc3)c2C)=C2CC2)c(C)c1 |
| InChI | InChI=1S/C26H27NO/c1-18-12-15-24(19(2)16-18)26(22-13-14-22)27-28-17-23-10-7-11-25(20(23)3)21-8-5-4-6-9-21/h4-12,15-16,27H,13-14,17H2,1-3H3 |
| InChIKey | ODQQPBCIRGCQGR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|