C7H10N4O2 — CID 141075048
(5R)-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one (PubChem CID 141075048) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is (5R)-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141075048 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (5R)-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cn(C[C@H]2CNC(=O)O2)nn1 |
| InChI | InChI=1S/C7H10N4O2/c1-5-3-11(10-9-5)4-6-2-8-7(12)13-6/h3,6H,2,4H2,1H3,(H,8,12)/t6-/m1/s1 |
| InChIKey | SNMNPCQLVQXACJ-ZCFIWIBFSA-N |
| XLogP | -0.31 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |