C19H34O6Si — CID 141075883
(E)-3-methyl-4-oxo-4-[5-oxo-5-tri(propan-2-yl)silyloxypentoxy]but-2-enoic acid (PubChem CID 141075883) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is (E)-3-methyl-4-oxo-4-[5-oxo-5-tri(propan-2-yl)silyloxypentoxy]but-2-enoic acid.
| Compound Name | (E)-3-methyl-4-oxo-4-[5-oxo-5-tri(propan-2-yl)silyloxypentoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 141075883 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (E)-3-methyl-4-oxo-4-[5-oxo-5-tri(propan-2-yl)silyloxypentoxy]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)C(=O)OCCCCC(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34O6Si/c1-13(2)26(14(3)4,15(5)6)25-18(22)10-8-9-11-24-19(23)16(7)12-17(20)21/h12-15H,8-11H2,1-7H3,(H,20,21)/b16-12+ |
| InChIKey | QAYKWLSQIXPJNQ-FOWTUZBSSA-N |
| XLogP | 4.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|