C19H36O6Si2 — CID 54175279
2-[[dimethyl-[4-(2-methylprop-2-enoyloxy)butyl]silyl]oxy-dimethylsilyl]-5-ethenoxypentanoic acid (PubChem CID 54175279) has the molecular formula C19H36O6Si2 and a molecular weight of 416.66 g/mol. Its IUPAC name is 2-[[dimethyl-[4-(2-methylprop-2-enoyloxy)butyl]silyl]oxy-dimethylsilyl]-5-ethenoxypentanoic acid.
| Compound Name | 2-[[dimethyl-[4-(2-methylprop-2-enoyloxy)butyl]silyl]oxy-dimethylsilyl]-5-ethenoxypentanoic acid |
|---|---|
| PubChem CID | 54175279 |
| Molecular Formula | C19H36O6Si2 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[[dimethyl-[4-(2-methylprop-2-enoyloxy)butyl]silyl]oxy-dimethylsilyl]-5-ethenoxypentanoic acid |
| SMILES | C=COCCCC(C(=O)O)[Si](C)(C)O[Si](C)(C)CCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C19H36O6Si2/c1-8-23-13-11-12-17(18(20)21)27(6,7)25-26(4,5)15-10-9-14-24-19(22)16(2)3/h8,17H,1-2,9-15H2,3-7H3,(H,20,21) |
| InChIKey | OXWIHSYZPNQHEZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|