C13H19N3O2 — CID 141076521
2-[2,2-diaminoethyl(3-phenylprop-2-enyl)amino]acetic acid (PubChem CID 141076521) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[2,2-diaminoethyl(3-phenylprop-2-enyl)amino]acetic acid.
| Compound Name | 2-[2,2-diaminoethyl(3-phenylprop-2-enyl)amino]acetic acid |
|---|---|
| PubChem CID | 141076521 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-[2,2-diaminoethyl(3-phenylprop-2-enyl)amino]acetic acid |
| SMILES | NC(N)CN(CC=Cc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C13H19N3O2/c14-12(15)9-16(10-13(17)18)8-4-7-11-5-2-1-3-6-11/h1-7,12H,8-10,14-15H2,(H,17,18) |
| InChIKey | MMSXMRPHYLWQHI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|