C17H22N2O3 — CID 134704642
(2S)-2-amino-5-[cyclopropyl-[(E)-3-phenylprop-2-enyl]amino]-5-oxopentanoic acid (PubChem CID 134704642) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S)-2-amino-5-[cyclopropyl-[(E)-3-phenylprop-2-enyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[cyclopropyl-[(E)-3-phenylprop-2-enyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134704642 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2S)-2-amino-5-[cyclopropyl-[(E)-3-phenylprop-2-enyl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N(C/C=C/c1ccccc1)C1CC1)C(=O)O |
| InChI | InChI=1S/C17H22N2O3/c18-15(17(21)22)10-11-16(20)19(14-8-9-14)12-4-7-13-5-2-1-3-6-13/h1-7,14-15H,8-12,18H2,(H,21,22)/b7-4+/t15-/m0/s1 |
| InChIKey | AICMLBVELZEKFD-SZTZYQKNSA-N |
| XLogP | 1.88 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |